About 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine
2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine (PubChem CID 139313671) has the molecular formula C18H36N2O2
and a molecular weight of 312.50 g/mol. Its IUPAC name is 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine.
Molecular Properties
| Compound Name | 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine |
| PubChem CID | 139313671 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine |
| SMILES | CC(C)CC1CNCC(CC(C)(C)CC2COCCN2C)O1 |
| InChI | InChI=1S/C18H36N2O2/c1-14(2)8-16-11-19-12-17(22-16)10-18(3,4)9-15-13-21-7-6-20(15)5/h14-17,19H,6-13H2,1-5H3 |
| InChIKey | KFJUTPBIWXONOY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine?
The IUPAC name of 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine (CID 139313671) is 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine.
What is the SMILES notation for 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine?
The canonical SMILES for 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine is CC(C)CC1CNCC(CC(C)(C)CC2COCCN2C)O1.
What is the InChIKey of 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine?
The InChIKey is KFJUTPBIWXONOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2O2/c1-14(2)8-16-11-19-12-17(22-16)10-18(3,4)9-15-13-21-7-6-20(15)5/h14-17,19H,6-13H2,1-5H3.
What are the key properties of 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine?
2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine has a molecular weight of 312.50 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethyl-3-(4-methylmorpholin-3-yl)propyl]-6-(2-methylpropyl)morpholine is sourced from PubChem (CID 139313671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).