About 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine
6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine (PubChem CID 139313677) has the molecular formula C10H16F2N6
and a molecular weight of 258.28 g/mol. Its IUPAC name is 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine |
| PubChem CID | 139313677 |
| Molecular Formula | C10H16F2N6 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine |
| SMILES | Nc1ncnc(N(N)C2CCCCC2(F)F)c1N |
| InChI | InChI=1S/C10H16F2N6/c11-10(12)4-2-1-3-6(10)18(15)9-7(13)8(14)16-5-17-9/h5-6H,1-4,13,15H2,(H2,14,16,17) |
| InChIKey | AKTJDSSDZMSZHU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine?
The IUPAC name of 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine (CID 139313677) is 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine.
What is the SMILES notation for 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine?
The canonical SMILES for 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine is Nc1ncnc(N(N)C2CCCCC2(F)F)c1N.
What is the InChIKey of 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine?
The InChIKey is AKTJDSSDZMSZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N6/c11-10(12)4-2-1-3-6(10)18(15)9-7(13)8(14)16-5-17-9/h5-6H,1-4,13,15H2,(H2,14,16,17).
What are the key properties of 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine?
6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine has a molecular weight of 258.28 g/mol, XLogP of 0.90, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[amino-(2,2-difluorocyclohexyl)amino]pyrimidine-4,5-diamine is sourced from PubChem (CID 139313677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).