About 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine
4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine (PubChem CID 139313894) has the molecular formula C11H15F2N5
and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine.
Molecular Properties
| Compound Name | 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine |
| PubChem CID | 139313894 |
| Molecular Formula | C11H15F2N5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine |
| SMILES | [H]/N=C(\[C@H]1CCCC(F)(F)C1)n1ccnc(N)/c1=N\[H] |
| InChI | InChI=1S/C11H15F2N5/c12-11(13)3-1-2-7(6-11)9(15)18-5-4-17-8(14)10(18)16/h4-5,7,15-16H,1-3,6H2,(H2,14,17)/b15-9+,16-10+/t7-/m0/s1 |
| InChIKey | DBZBTBVRFARKKQ-DSHCZZNOSA-N |
| XLogP | 1.60 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine?
The IUPAC name of 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine (CID 139313894) is 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine.
What is the SMILES notation for 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine?
The canonical SMILES for 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine is [H]/N=C(\[C@H]1CCCC(F)(F)C1)n1ccnc(N)/c1=N\[H].
What is the InChIKey of 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine?
The InChIKey is DBZBTBVRFARKKQ-DSHCZZNOSA-N. The full InChI is InChI=1S/C11H15F2N5/c12-11(13)3-1-2-7(6-11)9(15)18-5-4-17-8(14)10(18)16/h4-5,7,15-16H,1-3,6H2,(H2,14,17)/b15-9+,16-10+/t7-/m0/s1.
What are the key properties of 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine?
4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine has a molecular weight of 255.27 g/mol, XLogP of 1.60, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-3,3-difluorocyclohexanecarboximidoyl]-3-iminopyrazin-2-amine is sourced from PubChem (CID 139313894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).