C11H20N6 — CID 139313934
6-[amino-(3-methylcyclohexyl)amino]pyrimidine-4,5-diamine (PubChem CID 139313934) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is 6-[amino-(3-methylcyclohexyl)amino]pyrimidine-4,5-diamine.
| Compound Name | 6-[amino-(3-methylcyclohexyl)amino]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 139313934 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 6-[amino-(3-methylcyclohexyl)amino]pyrimidine-4,5-diamine |
| SMILES | CC1CCCC(N(N)c2ncnc(N)c2N)C1 |
| InChI | InChI=1S/C11H20N6/c1-7-3-2-4-8(5-7)17(14)11-9(12)10(13)15-6-16-11/h6-8H,2-5,12,14H2,1H3,(H2,13,15,16) |
| InChIKey | CQJQNTFWIOVGHF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|