C16H24N6 — CID 139314150
3-[(1S,2R,6R)-2,3-dimethyl-6-prop-1-en-2-ylcycloheptyl]triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 139314150) has the molecular formula C16H24N6 and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-[(1S,2R,6R)-2,3-dimethyl-6-prop-1-en-2-ylcycloheptyl]triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-[(1S,2R,6R)-2,3-dimethyl-6-prop-1-en-2-ylcycloheptyl]triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 139314150 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 3-[(1S,2R,6R)-2,3-dimethyl-6-prop-1-en-2-ylcycloheptyl]triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | C=C(C)[C@@H]1CCC(C)[C@@H](C)[C@@H](n2nnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C16H24N6/c1-9(2)12-6-5-10(3)11(4)13(7-12)22-16-14(20-21-22)15(17)18-8-19-16/h8,10-13H,1,5-7H2,2-4H3,(H2,17,18,19)/t10?,11-,12-,13+/m1/s1 |
| InChIKey | ZJQRMRNGWMYWOF-HYWTVENDSA-N |
| XLogP | 2.99 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|