C13H19F2N5 — CID 139314157
4-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine (PubChem CID 139314157) has the molecular formula C13H19F2N5 and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine.
| Compound Name | 4-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine |
|---|---|
| PubChem CID | 139314157 |
| Molecular Formula | C13H19F2N5 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-(3,3-difluoro-5,5-dimethylcyclohexanecarboximidoyl)-3-iminopyrazin-2-amine |
| SMILES | [H]/N=C(\C1CC(C)(C)CC(F)(F)C1)n1ccnc(N)/c1=N\[H] |
| InChI | InChI=1S/C13H19F2N5/c1-12(2)5-8(6-13(14,15)7-12)10(17)20-4-3-19-9(16)11(20)18/h3-4,8,17-18H,5-7H2,1-2H3,(H2,16,19)/b17-10+,18-11+ |
| InChIKey | QJQWOYXDLQGQOA-ODPUSEOTSA-N |
| XLogP | 2.23 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|