C17H33N3 — CID 139314352
N-[(1Z,5E)-3-ethyl-3-methyl-1-(propylamino)octa-1,5-dien-2-yl]-N'-methylethanimidamide (PubChem CID 139314352) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is N-[(1Z,5E)-3-ethyl-3-methyl-1-(propylamino)octa-1,5-dien-2-yl]-N'-methylethanimidamide.
| Compound Name | N-[(1Z,5E)-3-ethyl-3-methyl-1-(propylamino)octa-1,5-dien-2-yl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 139314352 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | N-[(1Z,5E)-3-ethyl-3-methyl-1-(propylamino)octa-1,5-dien-2-yl]-N'-methylethanimidamide |
| SMILES | CC/C=C/CC(C)(CC)/C(=C/NCCC)N/C(C)=N/C |
| InChI | InChI=1S/C17H33N3/c1-7-10-11-12-17(5,9-3)16(14-19-13-8-2)20-15(4)18-6/h10-11,14,19H,7-9,12-13H2,1-6H3,(H,18,20)/b11-10+,16-14- |
| InChIKey | FFABGTVCVQUKLA-LNCFZFMDSA-N |
| XLogP | 4.24 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|