C40H33N5 — CID 139314461
[(Z)-1-[4-[1-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-2-yl]phenyl]prop-1-enyl]hydrazine (PubChem CID 139314461) has the molecular formula C40H33N5 and a molecular weight of 583.74 g/mol. Its IUPAC name is [(Z)-1-[4-[1-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-2-yl]phenyl]prop-1-enyl]hydrazine.
| Compound Name | [(Z)-1-[4-[1-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-2-yl]phenyl]prop-1-enyl]hydrazine |
|---|---|
| PubChem CID | 139314461 |
| Molecular Formula | C40H33N5 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | [(Z)-1-[4-[1-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-2-yl]phenyl]prop-1-enyl]hydrazine |
| SMILES | C/C=C(\NN)c1ccc(-c2ccc3ccccc3c2-c2ccc(C3N=C(c4ccccc4)NC(c4ccccc4)=N3)cc2)cc1 |
| InChI | InChI=1S/C40H33N5/c1-2-36(45-41)29-19-17-28(18-20-29)35-26-25-27-11-9-10-16-34(27)37(35)30-21-23-33(24-22-30)40-43-38(31-12-5-3-6-13-31)42-39(44-40)32-14-7-4-8-15-32/h2-26,40,45H,41H2,1H3,(H,42,43,44)/b36-2- |
| InChIKey | XMVBMHFXIZORDO-NHEJZEQBSA-N |
| XLogP | 8.49 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|