C50H82N2O4 — CID 139314617
2-[8-[3-(8,9-dimethyldecyl)-5-hexyl-4-octylcyclohexyl]octyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 139314617) has the molecular formula C50H82N2O4 and a molecular weight of 775.22 g/mol. Its IUPAC name is 2-[8-[3-(8,9-dimethyldecyl)-5-hexyl-4-octylcyclohexyl]octyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[8-[3-(8,9-dimethyldecyl)-5-hexyl-4-octylcyclohexyl]octyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 139314617 |
| Molecular Formula | C50H82N2O4 |
| Molecular Weight | 775.22 g/mol |
| Exact Mass | 774.63 |
| IUPAC Name | 2-[8-[3-(8,9-dimethyldecyl)-5-hexyl-4-octylcyclohexyl]octyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCCCCCCCC1C(CCCCCC)CC(CCCCCCCCn2c(=O)c3cc4c(=O)[nH]c(=O)c4cc3c2=O)CC1CCCCCCCC(C)C(C)C |
| InChI | InChI=1S/C50H82N2O4/c1-6-8-10-12-19-25-31-42-40(29-23-11-9-7-2)33-39(34-41(42)30-24-18-15-16-21-27-38(5)37(3)4)28-22-17-13-14-20-26-32-52-49(55)45-35-43-44(36-46(45)50(52)56)48(54)51-47(43)53/h35-42H,6-34H2,1-5H3,(H,51,53,54) |
| InChIKey | VSMVPNQZZXKQDS-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.22 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|