C18H24FN — CID 139314624
4-(4-ethylcyclohexa-1,5-dien-1-yl)-2-[(3Z)-2-fluorohexa-3,5-dien-3-yl]-2,5-dihydro-1H-pyrrole (PubChem CID 139314624) has the molecular formula C18H24FN and a molecular weight of 273.40 g/mol. Its IUPAC name is 4-(4-ethylcyclohexa-1,5-dien-1-yl)-2-[(3Z)-2-fluorohexa-3,5-dien-3-yl]-2,5-dihydro-1H-pyrrole.
| Compound Name | 4-(4-ethylcyclohexa-1,5-dien-1-yl)-2-[(3Z)-2-fluorohexa-3,5-dien-3-yl]-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 139314624 |
| Molecular Formula | C18H24FN |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 4-(4-ethylcyclohexa-1,5-dien-1-yl)-2-[(3Z)-2-fluorohexa-3,5-dien-3-yl]-2,5-dihydro-1H-pyrrole |
| SMILES | C=C/C=C(\C(C)F)C1C=C(C2=CCC(CC)C=C2)CN1 |
| InChI | InChI=1S/C18H24FN/c1-4-6-17(13(3)19)18-11-16(12-20-18)15-9-7-14(5-2)8-10-15/h4,6-7,9-11,13-14,18,20H,1,5,8,12H2,2-3H3/b17-6+ |
| InChIKey | BQHSNUZUDJDMJZ-UBKPWBPPSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|