C35H36FN5O5S2 — CID 139314876
2-(phenyldisulfanyl)ethyl N-[2-[2-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylcarbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 139314876) has the molecular formula C35H36FN5O5S2 and a molecular weight of 689.84 g/mol. Its IUPAC name is 2-(phenyldisulfanyl)ethyl N-[2-[2-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylcarbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | 2-(phenyldisulfanyl)ethyl N-[2-[2-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylcarbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 139314876 |
| Molecular Formula | C35H36FN5O5S2 |
| Molecular Weight | 689.84 g/mol |
| Exact Mass | 689.21 |
| IUPAC Name | 2-(phenyldisulfanyl)ethyl N-[2-[2-[[4-(6-fluoro-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-2-yl)phenyl]methyl-methylcarbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CN(Cc1ccc(-c2[nH]c3cc(F)cc4c3c2CCNC4=O)cc1)C(=O)C1CCCN1C(=O)CNC(=O)OCCSSc1ccccc1 |
| InChI | InChI=1S/C35H36FN5O5S2/c1-40(21-22-9-11-23(12-10-22)32-26-13-14-37-33(43)27-18-24(36)19-28(39-32)31(26)27)34(44)29-8-5-15-41(29)30(42)20-38-35(45)46-16-17-47-48-25-6-3-2-4-7-25/h2-4,6-7,9-12,18-19,29,39H,5,8,13-17,20-21H2,1H3,(H,37,43)(H,38,45) |
| InChIKey | KRABZANUJFPDFI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.84 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|