C22H26N2O3S2 — CID 139314979
tert-butyl (E)-2-cyano-3-[10-[2-hydroxyethyl(methyl)amino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoate (PubChem CID 139314979) has the molecular formula C22H26N2O3S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is tert-butyl (E)-2-cyano-3-[10-[2-hydroxyethyl(methyl)amino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-2-cyano-3-[10-[2-hydroxyethyl(methyl)amino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139314979 |
| Molecular Formula | C22H26N2O3S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | tert-butyl (E)-2-cyano-3-[10-[2-hydroxyethyl(methyl)amino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoate |
| SMILES | CN(CCO)c1cc2c(s1)-c1sc(/C=C(\C#N)C(=O)OC(C)(C)C)cc1C2(C)C |
| InChI | InChI=1S/C22H26N2O3S2/c1-21(2,3)27-20(26)13(12-23)9-14-10-15-18(28-14)19-16(22(15,4)5)11-17(29-19)24(6)7-8-25/h9-11,25H,7-8H2,1-6H3/b13-9+ |
| InChIKey | OAKCELPOEQFHDE-UKTHLTGXSA-N |
| XLogP | 4.79 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|