C11H18N2O2 — CID 139315236
(E)-2-cyano-N-(2-methoxyethyl)-4,4-dimethylpent-2-enamide (PubChem CID 139315236) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-methoxyethyl)-4,4-dimethylpent-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-methoxyethyl)-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 139315236 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (E)-2-cyano-N-(2-methoxyethyl)-4,4-dimethylpent-2-enamide |
| SMILES | COCCNC(=O)/C(C#N)=C/C(C)(C)C |
| InChI | InChI=1S/C11H18N2O2/c1-11(2,3)7-9(8-12)10(14)13-5-6-15-4/h7H,5-6H2,1-4H3,(H,13,14)/b9-7+ |
| InChIKey | OMELNOMZEVYBAK-VQHVLOKHSA-N |
| XLogP | 1.25 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|