C40H55N3O6 — CID 139315354
6-[2,4-bis[3-(3-methoxypropyl)-2,4-dihydro-1,3-benzoxazin-6-yl]butan-2-yl]-3-(3-methoxypropyl)-2,4-dihydro-1,3-benzoxazine (PubChem CID 139315354) has the molecular formula C40H55N3O6 and a molecular weight of 673.89 g/mol. Its IUPAC name is 6-[2,4-bis[3-(3-methoxypropyl)-2,4-dihydro-1,3-benzoxazin-6-yl]butan-2-yl]-3-(3-methoxypropyl)-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-[2,4-bis[3-(3-methoxypropyl)-2,4-dihydro-1,3-benzoxazin-6-yl]butan-2-yl]-3-(3-methoxypropyl)-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 139315354 |
| Molecular Formula | C40H55N3O6 |
| Molecular Weight | 673.89 g/mol |
| Exact Mass | 673.41 |
| IUPAC Name | 6-[2,4-bis[3-(3-methoxypropyl)-2,4-dihydro-1,3-benzoxazin-6-yl]butan-2-yl]-3-(3-methoxypropyl)-2,4-dihydro-1,3-benzoxazine |
| SMILES | COCCCN1COc2ccc(CCC(C)(c3ccc4c(c3)CN(CCCOC)CO4)c3ccc4c(c3)CN(CCCOC)CO4)cc2C1 |
| InChI | InChI=1S/C40H55N3O6/c1-40(35-9-12-38-33(23-35)26-42(29-48-38)17-6-20-45-3,36-10-13-39-34(24-36)27-43(30-49-39)18-7-21-46-4)15-14-31-8-11-37-32(22-31)25-41(28-47-37)16-5-19-44-2/h8-13,22-24H,5-7,14-21,25-30H2,1-4H3 |
| InChIKey | HGGZDWIOSQCSOG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.89 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|