C14H25N — CID 139315391
N-[(3Z,5Z)-2,2,8,8-tetramethylnona-3,5-dien-3-yl]methanimine (PubChem CID 139315391) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-[(3Z,5Z)-2,2,8,8-tetramethylnona-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3Z,5Z)-2,2,8,8-tetramethylnona-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 139315391 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-[(3Z,5Z)-2,2,8,8-tetramethylnona-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C\C=C/CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H25N/c1-13(2,3)11-9-8-10-12(15-7)14(4,5)6/h8-10H,7,11H2,1-6H3/b9-8-,12-10- |
| InChIKey | KCDUMJARIKTIJH-DMGFJBLZSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|