C20H32N2 — CID 139315495
(Z)-2-[[(3E,4E)-5-tert-butyl-3-prop-2-enylidenehepta-4,6-dien-2-ylidene]amino]-3,3-dimethylbut-1-en-1-amine (PubChem CID 139315495) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is (Z)-2-[[(3E,4E)-5-tert-butyl-3-prop-2-enylidenehepta-4,6-dien-2-ylidene]amino]-3,3-dimethylbut-1-en-1-amine.
| Compound Name | (Z)-2-[[(3E,4E)-5-tert-butyl-3-prop-2-enylidenehepta-4,6-dien-2-ylidene]amino]-3,3-dimethylbut-1-en-1-amine |
|---|---|
| PubChem CID | 139315495 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | (Z)-2-[[(3E,4E)-5-tert-butyl-3-prop-2-enylidenehepta-4,6-dien-2-ylidene]amino]-3,3-dimethylbut-1-en-1-amine |
| SMILES | C=C/C=C(\C=C(/C=C)C(C)(C)C)C(/C)=N/C(=C\N)C(C)(C)C |
| InChI | InChI=1S/C20H32N2/c1-10-12-16(13-17(11-2)19(4,5)6)15(3)22-18(14-21)20(7,8)9/h10-14H,1-2,21H2,3-9H3/b16-12+,17-13+,18-14-,22-15+ |
| InChIKey | LVQOGRXNBFJNMZ-BVEUUERSSA-N |
| XLogP | 5.56 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|