C13H26N2O — CID 139315589
3-tert-butyl-N-propan-2-yl-2,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-6-amine (PubChem CID 139315589) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-tert-butyl-N-propan-2-yl-2,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-6-amine.
| Compound Name | 3-tert-butyl-N-propan-2-yl-2,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-6-amine |
|---|---|
| PubChem CID | 139315589 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 3-tert-butyl-N-propan-2-yl-2,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-6-amine |
| SMILES | CC(C)NC1CCC2C1OCN2C(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-9(2)14-10-6-7-11-12(10)16-8-15(11)13(3,4)5/h9-12,14H,6-8H2,1-5H3 |
| InChIKey | KCMFKCBDMBLSSG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |