C14H28N2O — CID 139315651
N,3-ditert-butyl-2,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-6-amine (PubChem CID 139315651) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is N,3-ditert-butyl-2,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-6-amine.
| Compound Name | N,3-ditert-butyl-2,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-6-amine |
|---|---|
| PubChem CID | 139315651 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | N,3-ditert-butyl-2,3a,4,5,6,6a-hexahydrocyclopenta[d][1,3]oxazol-6-amine |
| SMILES | CC(C)(C)NC1CCC2C1OCN2C(C)(C)C |
| InChI | InChI=1S/C14H28N2O/c1-13(2,3)15-10-7-8-11-12(10)17-9-16(11)14(4,5)6/h10-12,15H,7-9H2,1-6H3 |
| InChIKey | FEBDAMKCVJMYEX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |