C15H27N — CID 139315734
N-(3,3-dimethylbut-1-en-2-yl)-2,2,5-trimethylhex-4-en-3-imine (PubChem CID 139315734) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N-(3,3-dimethylbut-1-en-2-yl)-2,2,5-trimethylhex-4-en-3-imine.
| Compound Name | N-(3,3-dimethylbut-1-en-2-yl)-2,2,5-trimethylhex-4-en-3-imine |
|---|---|
| PubChem CID | 139315734 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N-(3,3-dimethylbut-1-en-2-yl)-2,2,5-trimethylhex-4-en-3-imine |
| SMILES | C=C(/N=C(\C=C(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H27N/c1-11(2)10-13(15(7,8)9)16-12(3)14(4,5)6/h10H,3H2,1-2,4-9H3/b16-13+ |
| InChIKey | QSZHARXIOFFGKC-DTQAZKPQSA-N |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|