C22H29N3O2 — CID 139316198
1-[(1R,6R)-2-heptyl-6-phenylcyclohexa-2,4-dien-1-yl]-4-methyl-1,2,4-triazolidine-3,5-dione (PubChem CID 139316198) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[(1R,6R)-2-heptyl-6-phenylcyclohexa-2,4-dien-1-yl]-4-methyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-[(1R,6R)-2-heptyl-6-phenylcyclohexa-2,4-dien-1-yl]-4-methyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 139316198 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-[(1R,6R)-2-heptyl-6-phenylcyclohexa-2,4-dien-1-yl]-4-methyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCCCCCC1=CC=C[C@H](c2ccccc2)[C@H]1n1[nH]c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H29N3O2/c1-3-4-5-6-8-14-18-15-11-16-19(17-12-9-7-10-13-17)20(18)25-22(27)24(2)21(26)23-25/h7,9-13,15-16,19-20H,3-6,8,14H2,1-2H3,(H,23,26)/t19-,20+/m1/s1 |
| InChIKey | KHJZOALOUCFFBY-UXHICEINSA-N |
| XLogP | 4.06 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|