About 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine
6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine (PubChem CID 139316259) has the molecular formula C13H16ClN3
and a molecular weight of 249.75 g/mol. Its IUPAC name is 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine |
| PubChem CID | 139316259 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine |
| SMILES | CCCN(CC)c1ccc2cc(Cl)cnc2n1 |
| InChI | InChI=1S/C13H16ClN3/c1-3-7-17(4-2)12-6-5-10-8-11(14)9-15-13(10)16-12/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | MGQXHAFBGNLIOQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine?
The IUPAC name of 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine (CID 139316259) is 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine.
What is the SMILES notation for 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine?
The canonical SMILES for 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine is CCCN(CC)c1ccc2cc(Cl)cnc2n1.
What is the InChIKey of 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine?
The InChIKey is MGQXHAFBGNLIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3/c1-3-7-17(4-2)12-6-5-10-8-11(14)9-15-13(10)16-12/h5-6,8-9H,3-4,7H2,1-2H3.
What are the key properties of 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine?
6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine has a molecular weight of 249.75 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-ethyl-N-propyl-1,8-naphthyridin-2-amine is sourced from PubChem (CID 139316259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).