C12H15N3O2 — CID 139316500
4-methyl-1-[(1S,6R)-6-prop-1-en-2-ylcyclohexa-2,4-dien-1-yl]-1,2,4-triazolidine-3,5-dione (PubChem CID 139316500) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-methyl-1-[(1S,6R)-6-prop-1-en-2-ylcyclohexa-2,4-dien-1-yl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-methyl-1-[(1S,6R)-6-prop-1-en-2-ylcyclohexa-2,4-dien-1-yl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 139316500 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-methyl-1-[(1S,6R)-6-prop-1-en-2-ylcyclohexa-2,4-dien-1-yl]-1,2,4-triazolidine-3,5-dione |
| SMILES | C=C(C)[C@H]1C=CC=C[C@@H]1n1[nH]c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H15N3O2/c1-8(2)9-6-4-5-7-10(9)15-12(17)14(3)11(16)13-15/h4-7,9-10H,1H2,2-3H3,(H,13,16)/t9-,10+/m1/s1 |
| InChIKey | HNLHEZNQKULABC-ZJUUUORDSA-N |
| XLogP | 0.73 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|