C20H16F3N3O2 — CID 139316510
4-methyl-1-[(1R,2R)-2-phenyl-8-(trifluoromethyl)-1,2-dihydronaphthalen-1-yl]-1,2,4-triazolidine-3,5-dione (PubChem CID 139316510) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 4-methyl-1-[(1R,2R)-2-phenyl-8-(trifluoromethyl)-1,2-dihydronaphthalen-1-yl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-methyl-1-[(1R,2R)-2-phenyl-8-(trifluoromethyl)-1,2-dihydronaphthalen-1-yl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 139316510 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-methyl-1-[(1R,2R)-2-phenyl-8-(trifluoromethyl)-1,2-dihydronaphthalen-1-yl]-1,2,4-triazolidine-3,5-dione |
| SMILES | Cn1c(=O)[nH]n([C@H]2c3c(cccc3C(F)(F)F)C=C[C@@H]2c2ccccc2)c1=O |
| InChI | InChI=1S/C20H16F3N3O2/c1-25-18(27)24-26(19(25)28)17-14(12-6-3-2-4-7-12)11-10-13-8-5-9-15(16(13)17)20(21,22)23/h2-11,14,17H,1H3,(H,24,27)/t14-,17-/m1/s1 |
| InChIKey | ZAVJROVPMOXATR-RHSMWYFYSA-N |
| XLogP | 3.29 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |