About [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite
[(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite (PubChem CID 139316554) has the molecular formula C12H12INS
and a molecular weight of 329.21 g/mol. Its IUPAC name is [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite.
Molecular Properties
| Compound Name | [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite |
| PubChem CID | 139316554 |
| Molecular Formula | C12H12INS |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite |
| SMILES | N[C@H]1C(SI)=CC=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H12INS/c13-15-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-8,10,12H,14H2/t10-,12-/m1/s1 |
| InChIKey | FPNWNJAYQCYVNK-ZYHUDNBSSA-N |
| XLogP | 3.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite?
The IUPAC name of [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite (CID 139316554) is [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite.
What is the SMILES notation for [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite?
The canonical SMILES for [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite is N[C@H]1C(SI)=CC=C[C@@H]1c1ccccc1.
What is the InChIKey of [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite?
The InChIKey is FPNWNJAYQCYVNK-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H12INS/c13-15-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-8,10,12H,14H2/t10-,12-/m1/s1.
What are the key properties of [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite?
[(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite has a molecular weight of 329.21 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R,6R)-6-amino-5-phenylcyclohexa-1,3-dien-1-yl] thiohypoiodite is sourced from PubChem (CID 139316554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).