About (3E)-2-ethyliminohepta-3,6-diene-3-thiol
(3E)-2-ethyliminohepta-3,6-diene-3-thiol (PubChem CID 139316707) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is (3E)-2-ethyliminohepta-3,6-diene-3-thiol.
Molecular Properties
| Compound Name | (3E)-2-ethyliminohepta-3,6-diene-3-thiol |
| PubChem CID | 139316707 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (3E)-2-ethyliminohepta-3,6-diene-3-thiol |
| SMILES | C=CC/C=C(S)\C(C)=N\CC |
| InChI | InChI=1S/C9H15NS/c1-4-6-7-9(11)8(3)10-5-2/h4,7,11H,1,5-6H2,2-3H3/b9-7+,10-8+ |
| InChIKey | SYGQNIOHPANOND-FIFLTTCUSA-N |
| XLogP | 2.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-ethyliminohepta-3,6-diene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-ethyliminohepta-3,6-diene-3-thiol?
The IUPAC name of (3E)-2-ethyliminohepta-3,6-diene-3-thiol (CID 139316707) is (3E)-2-ethyliminohepta-3,6-diene-3-thiol.
What is the SMILES notation for (3E)-2-ethyliminohepta-3,6-diene-3-thiol?
The canonical SMILES for (3E)-2-ethyliminohepta-3,6-diene-3-thiol is C=CC/C=C(S)\C(C)=N\CC.
What is the InChIKey of (3E)-2-ethyliminohepta-3,6-diene-3-thiol?
The InChIKey is SYGQNIOHPANOND-FIFLTTCUSA-N. The full InChI is InChI=1S/C9H15NS/c1-4-6-7-9(11)8(3)10-5-2/h4,7,11H,1,5-6H2,2-3H3/b9-7+,10-8+.
What are the key properties of (3E)-2-ethyliminohepta-3,6-diene-3-thiol?
(3E)-2-ethyliminohepta-3,6-diene-3-thiol has a molecular weight of 169.29 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-ethyliminohepta-3,6-diene-3-thiol is sourced from PubChem (CID 139316707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).