C12H20N2 — CID 139316986
(3Z,5E)-5-piperidin-1-ylhepta-1,3,5-trien-2-amine (PubChem CID 139316986) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (3Z,5E)-5-piperidin-1-ylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5-piperidin-1-ylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 139316986 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (3Z,5E)-5-piperidin-1-ylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C\C(=C/C)N1CCCCC1 |
| InChI | InChI=1S/C12H20N2/c1-3-12(8-7-11(2)13)14-9-5-4-6-10-14/h3,7-8H,2,4-6,9-10,13H2,1H3/b8-7-,12-3+ |
| InChIKey | NBXUQAAUXARXTG-SODSMJNWSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|