C12H17N3 — CID 139317025
(3Z)-N-ethenyl-3-ethylidene-1-methyl-4,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-imine (PubChem CID 139317025) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is (3Z)-N-ethenyl-3-ethylidene-1-methyl-4,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-imine.
| Compound Name | (3Z)-N-ethenyl-3-ethylidene-1-methyl-4,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-imine |
|---|---|
| PubChem CID | 139317025 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (3Z)-N-ethenyl-3-ethylidene-1-methyl-4,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-imine |
| SMILES | C=C/N=C1C(=C\C)/C2=C(CCNC2)N/1C |
| InChI | InChI=1S/C12H17N3/c1-4-9-10-8-13-7-6-11(10)15(3)12(9)14-5-2/h4-5,13H,2,6-8H2,1,3H3/b9-4-,14-12- |
| InChIKey | PCYLKUQVRWDDGD-VUFLTYHISA-N |
| XLogP | 1.67 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|