C50H96N4 — CID 139317100
1-ethyl-2,2,6,6-tetramethyl-4-[2,3,4-tris(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine (PubChem CID 139317100) has the molecular formula C50H96N4 and a molecular weight of 753.35 g/mol. Its IUPAC name is 1-ethyl-2,2,6,6-tetramethyl-4-[2,3,4-tris(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine.
| Compound Name | 1-ethyl-2,2,6,6-tetramethyl-4-[2,3,4-tris(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine |
|---|---|
| PubChem CID | 139317100 |
| Molecular Formula | C50H96N4 |
| Molecular Weight | 753.35 g/mol |
| Exact Mass | 752.76 |
| IUPAC Name | 1-ethyl-2,2,6,6-tetramethyl-4-[2,3,4-tris(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine |
| SMILES | CCN1C(C)(C)CC(C2CCC(C3CC(C)(C)N(CC)C(C)(C)C3)C(C3CC(C)(C)N(CC)C(C)(C)C3)C2C2CC(C)(C)N(CC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C50H96N4/c1-21-51-43(5,6)27-35(28-44(51,7)8)39-25-26-40(36-29-45(9,10)52(22-2)46(11,12)30-36)42(38-33-49(17,18)54(24-4)50(19,20)34-38)41(39)37-31-47(13,14)53(23-3)48(15,16)32-37/h35-42H,21-34H2,1-20H3 |
| InChIKey | GYXIKKBSIOUNEY-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.35 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |