About (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial
(2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial (PubChem CID 139317176) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial.
Molecular Properties
| Compound Name | (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial |
| PubChem CID | 139317176 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial |
| SMILES | C/C=C\C=C(/C=S)CN(C)C |
| InChI | InChI=1S/C9H15NS/c1-4-5-6-9(8-11)7-10(2)3/h4-6,8H,7H2,1-3H3/b5-4-,9-6- |
| InChIKey | NYNXWEDUYFYTHT-WXOLFVLTSA-N |
| XLogP | 2.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial?
The IUPAC name of (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial (CID 139317176) is (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial.
What is the SMILES notation for (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial?
The canonical SMILES for (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial is C/C=C\C=C(/C=S)CN(C)C.
What is the InChIKey of (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial?
The InChIKey is NYNXWEDUYFYTHT-WXOLFVLTSA-N. The full InChI is InChI=1S/C9H15NS/c1-4-5-6-9(8-11)7-10(2)3/h4-6,8H,7H2,1-3H3/b5-4-,9-6-.
What are the key properties of (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial?
(2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial has a molecular weight of 169.29 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-[(dimethylamino)methyl]hexa-2,4-dienethial is sourced from PubChem (CID 139317176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).