C16H28O — CID 139317185
(1S,2S,4R)-1-ethenyl-4-(2-methoxypropan-2-yl)-1-methyl-2-prop-1-en-2-ylcyclohexane (PubChem CID 139317185) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (1S,2S,4R)-1-ethenyl-4-(2-methoxypropan-2-yl)-1-methyl-2-prop-1-en-2-ylcyclohexane.
| Compound Name | (1S,2S,4R)-1-ethenyl-4-(2-methoxypropan-2-yl)-1-methyl-2-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 139317185 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (1S,2S,4R)-1-ethenyl-4-(2-methoxypropan-2-yl)-1-methyl-2-prop-1-en-2-ylcyclohexane |
| SMILES | C=C[C@]1(C)CC[C@@H](C(C)(C)OC)C[C@H]1C(=C)C |
| InChI | InChI=1S/C16H28O/c1-8-16(6)10-9-13(15(4,5)17-7)11-14(16)12(2)3/h8,13-14H,1-2,9-11H2,3-7H3/t13-,14+,16-/m1/s1 |
| InChIKey | CKRRDTINIUFWJM-IJEWVQPXSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|