C42H72F2N4O4 — CID 139317266
4-[2,5-difluoro-3,4,6-tris[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]phenoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 139317266) has the molecular formula C42H72F2N4O4 and a molecular weight of 735.06 g/mol. Its IUPAC name is 4-[2,5-difluoro-3,4,6-tris[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]phenoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[2,5-difluoro-3,4,6-tris[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]phenoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 139317266 |
| Molecular Formula | C42H72F2N4O4 |
| Molecular Weight | 735.06 g/mol |
| Exact Mass | 734.55 |
| IUPAC Name | 4-[2,5-difluoro-3,4,6-tris[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]phenoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(Oc2c(F)c(OC3CC(C)(C)NC(C)(C)C3)c(OC3CC(C)(C)NC(C)(C)C3)c(F)c2OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C42H72F2N4O4/c1-35(2)17-25(18-36(3,4)45-35)49-31-29(43)33(51-27-21-39(9,10)47-40(11,12)22-27)34(52-28-23-41(13,14)48-42(15,16)24-28)30(44)32(31)50-26-19-37(5,6)46-38(7,8)20-26/h25-28,45-48H,17-24H2,1-16H3 |
| InChIKey | PFAHFVRPOYBKOI-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.06 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |