C53H101N5 — CID 139317273
1,2,2,6,6-pentamethyl-4-[4-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine (PubChem CID 139317273) has the molecular formula C53H101N5 and a molecular weight of 808.43 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-[4-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-[4-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine |
|---|---|
| PubChem CID | 139317273 |
| Molecular Formula | C53H101N5 |
| Molecular Weight | 808.43 g/mol |
| Exact Mass | 807.81 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-[4-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine |
| SMILES | CN1C(C)(C)CC(C2CC(C3CC(C)(C)NC(C)(C)C3)C(C3CC(C)(C)N(C)C(C)(C)C3)C(C3CC(C)(C)NC(C)(C)C3)C2C2CC(C)(C)NC(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C53H101N5/c1-44(2)24-34(25-45(3,4)54-44)39-23-40(35-30-50(13,14)57(21)51(15,16)31-35)41(36-26-46(5,6)55-47(7,8)27-36)43(37-28-48(9,10)56-49(11,12)29-37)42(39)38-32-52(17,18)58(22)53(19,20)33-38/h34-43,54-56H,23-33H2,1-22H3 |
| InChIKey | LCZDJRLSJLLXRO-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.43 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |