C20H33N3 — CID 139317394
N-[(3Z,5E)-6-(ethylideneamino)-5-methylhexa-1,3,5-trien-3-yl]-1-(methylaminomethyl)-N-prop-1-enylcyclohexan-1-amine (PubChem CID 139317394) has the molecular formula C20H33N3 and a molecular weight of 315.51 g/mol. Its IUPAC name is N-[(3Z,5E)-6-(ethylideneamino)-5-methylhexa-1,3,5-trien-3-yl]-1-(methylaminomethyl)-N-prop-1-enylcyclohexan-1-amine.
| Compound Name | N-[(3Z,5E)-6-(ethylideneamino)-5-methylhexa-1,3,5-trien-3-yl]-1-(methylaminomethyl)-N-prop-1-enylcyclohexan-1-amine |
|---|---|
| PubChem CID | 139317394 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | N-[(3Z,5E)-6-(ethylideneamino)-5-methylhexa-1,3,5-trien-3-yl]-1-(methylaminomethyl)-N-prop-1-enylcyclohexan-1-amine |
| SMILES | C=C/C(=C/C(C)=C/N=C/C)N(C=CC)C1(CNC)CCCCC1 |
| InChI | InChI=1S/C20H33N3/c1-6-14-23(19(7-2)15-18(4)16-22-8-3)20(17-21-5)12-10-9-11-13-20/h6-8,14-16,21H,2,9-13,17H2,1,3-5H3/b14-6?,18-16+,19-15-,22-8+ |
| InChIKey | DXWUNXLATUJYKN-TWIHZVTFSA-N |
| XLogP | 4.81 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|