C42H80N4 — CID 139317413
2,2,6,6-tetramethyl-4-[2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine (PubChem CID 139317413) has the molecular formula C42H80N4 and a molecular weight of 641.13 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine |
|---|---|
| PubChem CID | 139317413 |
| Molecular Formula | C42H80N4 |
| Molecular Weight | 641.13 g/mol |
| Exact Mass | 640.64 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine |
| SMILES | CC1(C)CC(C2CCC(C3CC(C)(C)NC(C)(C)C3)C(C3CC(C)(C)NC(C)(C)C3)C2C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C42H80N4/c1-35(2)19-27(20-36(3,4)43-35)31-17-18-32(28-21-37(5,6)44-38(7,8)22-28)34(30-25-41(13,14)46-42(15,16)26-30)33(31)29-23-39(9,10)45-40(11,12)24-29/h27-34,43-46H,17-26H2,1-16H3 |
| InChIKey | HDWNITLQCSAIDL-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.13 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |