C41H78N4 — CID 139317604
2,2,6,6-tetramethyl-4-[2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclopentyl]piperidine (PubChem CID 139317604) has the molecular formula C41H78N4 and a molecular weight of 627.10 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclopentyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclopentyl]piperidine |
|---|---|
| PubChem CID | 139317604 |
| Molecular Formula | C41H78N4 |
| Molecular Weight | 627.10 g/mol |
| Exact Mass | 626.62 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[2,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)cyclopentyl]piperidine |
| SMILES | CC1(C)CC(C2CC(C3CC(C)(C)NC(C)(C)C3)C(C3CC(C)(C)NC(C)(C)C3)C2C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C41H78N4/c1-34(2)18-26(19-35(3,4)42-34)30-17-31(27-20-36(5,6)43-37(7,8)21-27)33(29-24-40(13,14)45-41(15,16)25-29)32(30)28-22-38(9,10)44-39(11,12)23-28/h26-33,42-45H,17-25H2,1-16H3 |
| InChIKey | DBRLMJLWFOWNBA-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.10 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |