C51H97N5 — CID 139317615
2,2,6,6-tetramethyl-4-[2,3,4,5-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine (PubChem CID 139317615) has the molecular formula C51H97N5 and a molecular weight of 780.37 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[2,3,4,5-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[2,3,4,5-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine |
|---|---|
| PubChem CID | 139317615 |
| Molecular Formula | C51H97N5 |
| Molecular Weight | 780.37 g/mol |
| Exact Mass | 779.77 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[2,3,4,5-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)cyclohexyl]piperidine |
| SMILES | CC1(C)CC(C2CC(C3CC(C)(C)NC(C)(C)C3)C(C3CC(C)(C)NC(C)(C)C3)C(C3CC(C)(C)NC(C)(C)C3)C2C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C51H97N5/c1-42(2)22-32(23-43(3,4)52-42)37-21-38(33-24-44(5,6)53-45(7,8)25-33)40(35-28-48(13,14)55-49(15,16)29-35)41(36-30-50(17,18)56-51(19,20)31-36)39(37)34-26-46(9,10)54-47(11,12)27-34/h32-41,52-56H,21-31H2,1-20H3 |
| InChIKey | KPANOYNIDPLBJB-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.37 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |