About 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine
1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine (PubChem CID 139317934) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine.
Molecular Properties
| Compound Name | 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine |
| PubChem CID | 139317934 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine |
| SMILES | C/C=C\NC(N)C1C=CC(C)=CC1 |
| InChI | InChI=1S/C11H18N2/c1-3-8-13-11(12)10-6-4-9(2)5-7-10/h3-6,8,10-11,13H,7,12H2,1-2H3/b8-3- |
| InChIKey | UCJWYKXTJDKUEI-BAQGIRSFSA-N |
| XLogP | 1.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine?
The IUPAC name of 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine (CID 139317934) is 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine.
What is the SMILES notation for 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine?
The canonical SMILES for 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine is C/C=C\NC(N)C1C=CC(C)=CC1.
What is the InChIKey of 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine?
The InChIKey is UCJWYKXTJDKUEI-BAQGIRSFSA-N. The full InChI is InChI=1S/C11H18N2/c1-3-8-13-11(12)10-6-4-9(2)5-7-10/h3-6,8,10-11,13H,7,12H2,1-2H3/b8-3-.
What are the key properties of 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine?
1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine has a molecular weight of 178.28 g/mol, XLogP of 1.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylcyclohexa-2,4-dien-1-yl)-N'-[(Z)-prop-1-enyl]methanediamine is sourced from PubChem (CID 139317934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).