About 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine
1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine (PubChem CID 139317991) has the molecular formula C13H21F2N
and a molecular weight of 229.31 g/mol. Its IUPAC name is 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine.
Molecular Properties
| Compound Name | 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine |
| PubChem CID | 139317991 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine |
| SMILES | CC/C(=C\C=C(C)C)CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H21F2N/c1-4-12(6-5-11(2)3)9-16-8-7-13(14,15)10-16/h5-6H,4,7-10H2,1-3H3/b12-6+ |
| InChIKey | YSSVXJVZDIORMI-WUXMJOGZSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine?
The IUPAC name of 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine (CID 139317991) is 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine.
What is the SMILES notation for 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine?
The canonical SMILES for 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine is CC/C(=C\C=C(C)C)CN1CCC(F)(F)C1.
What is the InChIKey of 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine?
The InChIKey is YSSVXJVZDIORMI-WUXMJOGZSA-N. The full InChI is InChI=1S/C13H21F2N/c1-4-12(6-5-11(2)3)9-16-8-7-13(14,15)10-16/h5-6H,4,7-10H2,1-3H3/b12-6+.
What are the key properties of 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine?
1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine has a molecular weight of 229.31 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-2-ethyl-5-methylhexa-2,4-dienyl]-3,3-difluoropyrrolidine is sourced from PubChem (CID 139317991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).