About 7-methyltetradecan-7-yl morpholine-4-carboxylate
7-methyltetradecan-7-yl morpholine-4-carboxylate (PubChem CID 139318939) has the molecular formula C20H39NO3
and a molecular weight of 341.54 g/mol. Its IUPAC name is 7-methyltetradecan-7-yl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | 7-methyltetradecan-7-yl morpholine-4-carboxylate |
| PubChem CID | 139318939 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | 7-methyltetradecan-7-yl morpholine-4-carboxylate |
| SMILES | CCCCCCCC(C)(CCCCCC)OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H39NO3/c1-4-6-8-10-12-14-20(3,13-11-9-7-5-2)24-19(22)21-15-17-23-18-16-21/h4-18H2,1-3H3 |
| InChIKey | UUOIQVDHNZSPSJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyltetradecan-7-yl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyltetradecan-7-yl morpholine-4-carboxylate?
The IUPAC name of 7-methyltetradecan-7-yl morpholine-4-carboxylate (CID 139318939) is 7-methyltetradecan-7-yl morpholine-4-carboxylate.
What is the SMILES notation for 7-methyltetradecan-7-yl morpholine-4-carboxylate?
The canonical SMILES for 7-methyltetradecan-7-yl morpholine-4-carboxylate is CCCCCCCC(C)(CCCCCC)OC(=O)N1CCOCC1.
What is the InChIKey of 7-methyltetradecan-7-yl morpholine-4-carboxylate?
The InChIKey is UUOIQVDHNZSPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO3/c1-4-6-8-10-12-14-20(3,13-11-9-7-5-2)24-19(22)21-15-17-23-18-16-21/h4-18H2,1-3H3.
What are the key properties of 7-methyltetradecan-7-yl morpholine-4-carboxylate?
7-methyltetradecan-7-yl morpholine-4-carboxylate has a molecular weight of 341.54 g/mol, XLogP of 5.54, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyltetradecan-7-yl morpholine-4-carboxylate is sourced from PubChem (CID 139318939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).