About (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine
(Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine (PubChem CID 139319189) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine.
Molecular Properties
| Compound Name | (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine |
| PubChem CID | 139319189 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine |
| SMILES | CCC(/C=C\C(=N/N)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26N2/c1-7-11(13(4,5)6)8-9-12(15-14)10(2)3/h8-11H,7,14H2,1-6H3/b9-8-,15-12+ |
| InChIKey | IDYHRQDFFQIBGI-LNJBCKSWSA-N |
| XLogP | 3.59 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine?
The IUPAC name of (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine (CID 139319189) is (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine.
What is the SMILES notation for (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine?
The canonical SMILES for (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine is CCC(/C=C\C(=N/N)C(C)C)C(C)(C)C.
What is the InChIKey of (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine?
The InChIKey is IDYHRQDFFQIBGI-LNJBCKSWSA-N. The full InChI is InChI=1S/C13H26N2/c1-7-11(13(4,5)6)8-9-12(15-14)10(2)3/h8-11H,7,14H2,1-6H3/b9-8-,15-12+.
What are the key properties of (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine?
(Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine has a molecular weight of 210.36 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-[(Z)-6-ethyl-2,7,7-trimethyloct-4-en-3-ylidene]hydrazine is sourced from PubChem (CID 139319189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).