C17H22F2N4O3S2 — CID 139319944
1-[6-[(2,2-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]ethyl methanesulfonate (PubChem CID 139319944) has the molecular formula C17H22F2N4O3S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[6-[(2,2-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]ethyl methanesulfonate.
| Compound Name | 1-[6-[(2,2-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 139319944 |
| Molecular Formula | C17H22F2N4O3S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[6-[(2,2-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]ethyl methanesulfonate |
| SMILES | Cc1csc(-c2nc(NC3CCCCC3(F)F)cc(C(C)OS(C)(=O)=O)n2)n1 |
| InChI | InChI=1S/C17H22F2N4O3S2/c1-10-9-27-16(20-10)15-21-12(11(2)26-28(3,24)25)8-14(23-15)22-13-6-4-5-7-17(13,18)19/h8-9,11,13H,4-7H2,1-3H3,(H,21,22,23) |
| InChIKey | YBJOOARQUBDMKM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|