About 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine
4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine (PubChem CID 139320034) has the molecular formula C14H16ClF2N5
and a molecular weight of 327.77 g/mol. Its IUPAC name is 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine |
| PubChem CID | 139320034 |
| Molecular Formula | C14H16ClF2N5 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine |
| SMILES | Cc1ccnn1-c1cc(Cl)nc(NC2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C14H16ClF2N5/c1-9-4-7-18-22(9)12-8-11(15)20-13(21-12)19-10-2-5-14(16,17)6-3-10/h4,7-8,10H,2-3,5-6H2,1H3,(H,19,20,21) |
| InChIKey | RPJOYUTWMWMYRX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine?
The IUPAC name of 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine (CID 139320034) is 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine.
What is the SMILES notation for 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine?
The canonical SMILES for 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine is Cc1ccnn1-c1cc(Cl)nc(NC2CCC(F)(F)CC2)n1.
What is the InChIKey of 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine?
The InChIKey is RPJOYUTWMWMYRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClF2N5/c1-9-4-7-18-22(9)12-8-11(15)20-13(21-12)19-10-2-5-14(16,17)6-3-10/h4,7-8,10H,2-3,5-6H2,1H3,(H,19,20,21).
What are the key properties of 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine?
4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine has a molecular weight of 327.77 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4,4-difluorocyclohexyl)-6-(5-methylpyrazol-1-yl)pyrimidin-2-amine is sourced from PubChem (CID 139320034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).