C11H20F2N6 — CID 139320086
[6-(4,4-difluorocyclohexyl)imino-2-hydrazinyl-4,5-dihydro-1H-pyrimidin-4-yl]methanamine (PubChem CID 139320086) has the molecular formula C11H20F2N6 and a molecular weight of 274.32 g/mol. Its IUPAC name is [6-(4,4-difluorocyclohexyl)imino-2-hydrazinyl-4,5-dihydro-1H-pyrimidin-4-yl]methanamine.
| Compound Name | [6-(4,4-difluorocyclohexyl)imino-2-hydrazinyl-4,5-dihydro-1H-pyrimidin-4-yl]methanamine |
|---|---|
| PubChem CID | 139320086 |
| Molecular Formula | C11H20F2N6 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [6-(4,4-difluorocyclohexyl)imino-2-hydrazinyl-4,5-dihydro-1H-pyrimidin-4-yl]methanamine |
| SMILES | NCC1C/C(=N\C2CCC(F)(F)CC2)NC(NN)=N1 |
| InChI | InChI=1S/C11H20F2N6/c12-11(13)3-1-7(2-4-11)16-9-5-8(6-14)17-10(18-9)19-15/h7-8H,1-6,14-15H2,(H2,16,17,18,19) |
| InChIKey | HRPVRIRWTFEDBI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|