C34H65NS2 — CID 139320265
2-[2-(2-hexyl-2-methylnonyl)sulfanylethyl]-5-(5-methyldodecan-5-yl)-1,3-thiazole (PubChem CID 139320265) has the molecular formula C34H65NS2 and a molecular weight of 552.04 g/mol. Its IUPAC name is 2-[2-(2-hexyl-2-methylnonyl)sulfanylethyl]-5-(5-methyldodecan-5-yl)-1,3-thiazole.
| Compound Name | 2-[2-(2-hexyl-2-methylnonyl)sulfanylethyl]-5-(5-methyldodecan-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 139320265 |
| Molecular Formula | C34H65NS2 |
| Molecular Weight | 552.04 g/mol |
| Exact Mass | 551.46 |
| IUPAC Name | 2-[2-(2-hexyl-2-methylnonyl)sulfanylethyl]-5-(5-methyldodecan-5-yl)-1,3-thiazole |
| SMILES | CCCCCCCC(C)(CCCCCC)CSCCc1ncc(C(C)(CCCC)CCCCCCC)s1 |
| InChI | InChI=1S/C34H65NS2/c1-7-11-15-18-21-25-33(5,24-20-17-13-9-3)30-36-28-23-32-35-29-31(37-32)34(6,26-14-10-4)27-22-19-16-12-8-2/h29H,7-28,30H2,1-6H3 |
| InChIKey | KVPIZBJDZROFIX-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.04 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|