C20H24BrN — CID 139320726
N-[(3E,5E)-6-bromohepta-1,3,5-trien-3-yl]-1-cyclohexyl-1-phenylmethanimine (PubChem CID 139320726) has the molecular formula C20H24BrN and a molecular weight of 358.32 g/mol. Its IUPAC name is N-[(3E,5E)-6-bromohepta-1,3,5-trien-3-yl]-1-cyclohexyl-1-phenylmethanimine.
| Compound Name | N-[(3E,5E)-6-bromohepta-1,3,5-trien-3-yl]-1-cyclohexyl-1-phenylmethanimine |
|---|---|
| PubChem CID | 139320726 |
| Molecular Formula | C20H24BrN |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[(3E,5E)-6-bromohepta-1,3,5-trien-3-yl]-1-cyclohexyl-1-phenylmethanimine |
| SMILES | C=CC(=C\C=C(/C)Br)/N=C(\c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H24BrN/c1-3-19(15-14-16(2)21)22-20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h3-4,6-7,10-11,14-15,18H,1,5,8-9,12-13H2,2H3/b16-14+,19-15+,22-20+ |
| InChIKey | GYLNUOYKZMAEQR-YQWOQHLTSA-N |
| XLogP | 6.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|