C13H14N2O7 — CID 139320839
dimethyl 4-[(2-methoxy-2-oxoethyl)carbamoyl]pyridine-2,6-dicarboxylate (PubChem CID 139320839) has the molecular formula C13H14N2O7 and a molecular weight of 310.26 g/mol. Its IUPAC name is dimethyl 4-[(2-methoxy-2-oxoethyl)carbamoyl]pyridine-2,6-dicarboxylate.
| Compound Name | dimethyl 4-[(2-methoxy-2-oxoethyl)carbamoyl]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 139320839 |
| Molecular Formula | C13H14N2O7 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | dimethyl 4-[(2-methoxy-2-oxoethyl)carbamoyl]pyridine-2,6-dicarboxylate |
| SMILES | COC(=O)CNC(=O)c1cc(C(=O)OC)nc(C(=O)OC)c1 |
| InChI | InChI=1S/C13H14N2O7/c1-20-10(16)6-14-11(17)7-4-8(12(18)21-2)15-9(5-7)13(19)22-3/h4-5H,6H2,1-3H3,(H,14,17) |
| InChIKey | RGNGRJKDZZYTNF-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|