C18H30O4 — CID 139321107
2-[hydroxy(2,2,5-trimethylhexan-3-yloxy)methyl]-6-methylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 139321107) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 2-[hydroxy(2,2,5-trimethylhexan-3-yloxy)methyl]-6-methylcyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 2-[hydroxy(2,2,5-trimethylhexan-3-yloxy)methyl]-6-methylcyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 139321107 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-[hydroxy(2,2,5-trimethylhexan-3-yloxy)methyl]-6-methylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CC(C)CC(OC(O)C1=C(C(=O)O)C(C)CC=C1)C(C)(C)C |
| InChI | InChI=1S/C18H30O4/c1-11(2)10-14(18(4,5)6)22-17(21)13-9-7-8-12(3)15(13)16(19)20/h7,9,11-12,14,17,21H,8,10H2,1-6H3,(H,19,20) |
| InChIKey | WNWLMSBGAFRDLH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|