About N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine
N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine (PubChem CID 139321602) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine |
| PubChem CID | 139321602 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine |
| SMILES | CC1=NC=CC(C)C1NC(C)C1CC1 |
| InChI | InChI=1S/C12H20N2/c1-8-6-7-13-10(3)12(8)14-9(2)11-4-5-11/h6-9,11-12,14H,4-5H2,1-3H3 |
| InChIKey | NYWPRFOXZADIAU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine?
The IUPAC name of N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine (CID 139321602) is N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine.
What is the SMILES notation for N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine?
The canonical SMILES for N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine is CC1=NC=CC(C)C1NC(C)C1CC1.
What is the InChIKey of N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine?
The InChIKey is NYWPRFOXZADIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-8-6-7-13-10(3)12(8)14-9(2)11-4-5-11/h6-9,11-12,14H,4-5H2,1-3H3.
What are the key properties of N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine?
N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine has a molecular weight of 192.31 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropylethyl)-2,4-dimethyl-3,4-dihydropyridin-3-amine is sourced from PubChem (CID 139321602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).