C42H28F6N4 — CID 139321889
4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-N,N-diphenylaniline (PubChem CID 139321889) has the molecular formula C42H28F6N4 and a molecular weight of 702.70 g/mol. Its IUPAC name is 4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 139321889 |
| Molecular Formula | C42H28F6N4 |
| Molecular Weight | 702.70 g/mol |
| Exact Mass | 702.22 |
| IUPAC Name | 4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-N,N-diphenylaniline |
| SMILES | FC(F)(F)C(c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1)(c1ccc(N(c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C42H28F6N4/c43-41(44,45)40(42(46,47)48,33-25-27-36(28-26-33)52(34-17-9-3-10-18-34)35-19-11-4-12-20-35)32-23-21-31(22-24-32)39-50-37(29-13-5-1-6-14-29)49-38(51-39)30-15-7-2-8-16-30/h1-28H |
| InChIKey | KDYJNSBRPGFCLT-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.70 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |