C45H32F6N4 — CID 139321907
10-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-9,9-dimethylacridine (PubChem CID 139321907) has the molecular formula C45H32F6N4 and a molecular weight of 742.77 g/mol. Its IUPAC name is 10-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-9,9-dimethylacridine.
| Compound Name | 10-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 139321907 |
| Molecular Formula | C45H32F6N4 |
| Molecular Weight | 742.77 g/mol |
| Exact Mass | 742.25 |
| IUPAC Name | 10-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2ccc(C(c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)(C(F)(F)F)C(F)(F)F)cc2)c2ccccc21 |
| InChI | InChI=1S/C45H32F6N4/c1-42(2)35-17-9-11-19-37(35)55(38-20-12-10-18-36(38)42)34-27-25-33(26-28-34)43(44(46,47)48,45(49,50)51)32-23-21-31(22-24-32)41-53-39(29-13-5-3-6-14-29)52-40(54-41)30-15-7-4-8-16-30/h3-28H,1-2H3 |
| InChIKey | NFFNQLPMWLPFGW-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.77 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |